Diethyl 2-formylbutanedioate
diethyl formylsuccinate
CAS: 5472-38-8
Molecular Formula: C9H14O5
Diethyl 2-formylbutanedioate - Names and Identifiers
| Name | diethyl formylsuccinate |
| Synonyms | diethyl formylsuccinate DIETHYL FORMYLSUCCINATE diethyl 2-formylsuccinate diethyl 2-forMylsuccinate iethyl2-formylbutanedioate Diethyl 2-formylbutanedioat diethyl 2-formylbutanedioate Diethyl 2-formylbutanedioate Butanedioic acid,2-forMyl-, 1,4-diethyl ester |
| CAS | 5472-38-8 |
| InChI | InChI=1/C9H14O5/c1-3-13-8(11)5-7(6-10)9(12)14-4-2/h6-7H,3-5H2,1-2H3 |
Diethyl 2-formylbutanedioate - Physico-chemical Properties
| Molecular Formula | C9H14O5 |
| Molar Mass | 202.2 |
| Density | 1.1840 (rough estimate) |
| Boling Point | 260.32°C (rough estimate) |
| Flash Point | 119.9°C |
| Vapor Presure | 0.00363mmHg at 25°C |
| pKa | 6.85±0.59(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.4486 (estimate) |
Diethyl 2-formylbutanedioate - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
Diethyl 2-formylbutanedioate - Introduction
The nature of the diethyl formylsuccinate(diethyl formylsuccinate) is as follows:
1. appearance: colorless liquid.
2. molecular formula: C10H16O4.
3. Molecular weight: 200.23g/mol.
4. Boiling point: about 235-236°C.
5. Melting point: about -2°C.
6. Density: about 1.058 g/mL.
7. Solubility: insoluble in water, but soluble in ethanol and ether solvents.
diethyl formylsuccinate are mainly used in the field of organic synthesis, including but not limited to the following:
1. as an esterification reagent: it can be used for esterification reaction in organic synthesis and for the synthesis of esters.
2. as a protective agent: can be used to protect aldehyde functional groups to prevent it from being affected by other reactions.
3. as a reagent: can be used as a reagent in organic synthesis, participate in various organic reactions.
The preparation method of diethyl formylsuccinate is mainly obtained by reacting diethyl succinate with formic acid vapor at an appropriate temperature and pressure. The process of the reaction requires the use of an acid catalyst and is controlled under appropriate conditions.
Regarding safety information, the specific safety instructions of diethyl formylsuccinate are as follows:
1. Avoid inhaling aerosols, vapors or smoke.
2. avoid contact with skin, eyes or clothing.
3. Wear appropriate protective equipment such as gloves, goggles and protective clothing during use.
4. Use in a well-ventilated area, away from fire and heat sources.
5. Do not dump the residue into the sewer or soil.
When using diethyl formylsuccinate, it is recommended to operate in strict accordance with relevant safety procedures and instructions to ensure personal safety and environmental safety. Please use under the guidance of professionals.
1. appearance: colorless liquid.
2. molecular formula: C10H16O4.
3. Molecular weight: 200.23g/mol.
4. Boiling point: about 235-236°C.
5. Melting point: about -2°C.
6. Density: about 1.058 g/mL.
7. Solubility: insoluble in water, but soluble in ethanol and ether solvents.
diethyl formylsuccinate are mainly used in the field of organic synthesis, including but not limited to the following:
1. as an esterification reagent: it can be used for esterification reaction in organic synthesis and for the synthesis of esters.
2. as a protective agent: can be used to protect aldehyde functional groups to prevent it from being affected by other reactions.
3. as a reagent: can be used as a reagent in organic synthesis, participate in various organic reactions.
The preparation method of diethyl formylsuccinate is mainly obtained by reacting diethyl succinate with formic acid vapor at an appropriate temperature and pressure. The process of the reaction requires the use of an acid catalyst and is controlled under appropriate conditions.
Regarding safety information, the specific safety instructions of diethyl formylsuccinate are as follows:
1. Avoid inhaling aerosols, vapors or smoke.
2. avoid contact with skin, eyes or clothing.
3. Wear appropriate protective equipment such as gloves, goggles and protective clothing during use.
4. Use in a well-ventilated area, away from fire and heat sources.
5. Do not dump the residue into the sewer or soil.
When using diethyl formylsuccinate, it is recommended to operate in strict accordance with relevant safety procedures and instructions to ensure personal safety and environmental safety. Please use under the guidance of professionals.
Last Update：2024-04-10 22:43:14
Supplier List
Product Name: DIETHYL FORMYLSUCCINATE Visit Supplier Webpage Request for quotation
CAS: 5472-38-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 5472-38-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
Product Name: DIETHYL FORMYLSUCCINATE Visit Supplier Webpage Request for quotation
CAS: 5472-38-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
CAS: 5472-38-8
Tel: 18301782025
Email: 3008007409@qq.com
Mobile: 18021002903
QQ: 3008007409
Wechat: 18301782025
View History